C32H56O6 — CID 44582337
(7R,8S,10S,11Z,13S,14R,15S,17S,20R)-8,10,14-trihydroxy-20-[(2R,3S,4S,5Z)-3-hydroxy-4-methylocta-5,7-dien-2-yl]-7,13,15,17-tetramethyl-1-oxacycloicos-11-en-2-one (PubChem CID 44582337) has the molecular formula C32H56O6 and a molecular weight of 536.79 g/mol. Its IUPAC name is (7R,8S,10S,11Z,13S,14R,15S,17S,20R)-8,10,14-trihydroxy-20-[(2R,3S,4S,5Z)-3-hydroxy-4-methylocta-5,7-dien-2-yl]-7,13,15,17-tetramethyl-1-oxacycloicos-11-en-2-one.
| Compound Name | (7R,8S,10S,11Z,13S,14R,15S,17S,20R)-8,10,14-trihydroxy-20-[(2R,3S,4S,5Z)-3-hydroxy-4-methylocta-5,7-dien-2-yl]-7,13,15,17-tetramethyl-1-oxacycloicos-11-en-2-one |
|---|---|
| PubChem CID | 44582337 |
| Molecular Formula | C32H56O6 |
| Molecular Weight | 536.79 g/mol |
| Exact Mass | 536.41 |
| IUPAC Name | (7R,8S,10S,11Z,13S,14R,15S,17S,20R)-8,10,14-trihydroxy-20-[(2R,3S,4S,5Z)-3-hydroxy-4-methylocta-5,7-dien-2-yl]-7,13,15,17-tetramethyl-1-oxacycloicos-11-en-2-one |
| SMILES | C=C/C=C\[C@H](C)[C@H](O)[C@@H](C)[C@H]1CC[C@H](C)C[C@H](C)[C@@H](O)[C@@H](C)/C=C\[C@@H](O)C[C@H](O)[C@H](C)CCCCC(=O)O1 |
| InChI | InChI=1S/C32H56O6/c1-8-9-12-23(4)32(37)26(7)29-18-15-21(2)19-25(6)31(36)24(5)16-17-27(33)20-28(34)22(3)13-10-11-14-30(35)38-29/h8-9,12,16-17,21-29,31-34,36-37H,1,10-11,13-15,18-20H2,2-7H3/b12-9-,17-16-/t21-,22+,23-,24-,25-,26-,27+,28-,29+,31-,32-/m0/s1 |
| InChIKey | MSJDZYJSVXFWKD-GZLSDFCXSA-N |
| XLogP | 5.59 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.79 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|