About 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one
8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one (PubChem CID 44582523) has the molecular formula C18H15NO2
and a molecular weight of 277.32 g/mol. Its IUPAC name is 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one.
Molecular Properties
| Compound Name | 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one |
| PubChem CID | 44582523 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one |
| SMILES | O=c1ccc2c(o1)-c1cn(Cc3ccccc3)cc1CC2 |
| InChI | InChI=1S/C18H15NO2/c20-17-9-8-14-6-7-15-11-19(12-16(15)18(14)21-17)10-13-4-2-1-3-5-13/h1-5,8-9,11-12H,6-7,10H2 |
| InChIKey | UOGWWAKBHXGMOA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one?
The IUPAC name of 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one (CID 44582523) is 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one.
What is the SMILES notation for 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one?
The canonical SMILES for 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one is O=c1ccc2c(o1)-c1cn(Cc3ccccc3)cc1CC2.
What is the InChIKey of 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one?
The InChIKey is UOGWWAKBHXGMOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO2/c20-17-9-8-14-6-7-15-11-19(12-16(15)18(14)21-17)10-13-4-2-1-3-5-13/h1-5,8-9,11-12H,6-7,10H2.
What are the key properties of 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one?
8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one has a molecular weight of 277.32 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzyl-5,6-dihydropyrano[2,3-e]isoindol-2-one is sourced from PubChem (CID 44582523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).