About [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol
[(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol (PubChem CID 44582608) has the molecular formula C16H26N2O3
and a molecular weight of 294.40 g/mol. Its IUPAC name is [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol |
| PubChem CID | 44582608 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol |
| SMILES | COC(CN1CCN(Cc2ccccc2)[C@@H](CO)C1)OC |
| InChI | InChI=1S/C16H26N2O3/c1-20-16(21-2)12-17-8-9-18(15(11-17)13-19)10-14-6-4-3-5-7-14/h3-7,15-16,19H,8-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | QDWLCSVLVCKQMQ-OAHLLOKOSA-N |
| XLogP | 0.78 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol?
The IUPAC name of [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol (CID 44582608) is [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol.
What is the SMILES notation for [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol?
The canonical SMILES for [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol is COC(CN1CCN(Cc2ccccc2)[C@@H](CO)C1)OC.
What is the InChIKey of [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol?
The InChIKey is QDWLCSVLVCKQMQ-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H26N2O3/c1-20-16(21-2)12-17-8-9-18(15(11-17)13-19)10-14-6-4-3-5-7-14/h3-7,15-16,19H,8-13H2,1-2H3/t15-/m1/s1.
What are the key properties of [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol?
[(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol has a molecular weight of 294.40 g/mol, XLogP of 0.78, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-benzyl-4-(2,2-dimethoxyethyl)piperazin-2-yl]methanol is sourced from PubChem (CID 44582608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).