C21H28O7 — CID 44582777
[(3aR,4R,6E,9R,10Z,11aS)-9-(hydroxymethyl)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (E)-4-hydroxy-2-(hydroxymethyl)but-2-enoate (PubChem CID 44582777) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is [(3aR,4R,6E,9R,10Z,11aS)-9-(hydroxymethyl)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (E)-4-hydroxy-2-(hydroxymethyl)but-2-enoate.
| Compound Name | [(3aR,4R,6E,9R,10Z,11aS)-9-(hydroxymethyl)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (E)-4-hydroxy-2-(hydroxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 44582777 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [(3aR,4R,6E,9R,10Z,11aS)-9-(hydroxymethyl)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (E)-4-hydroxy-2-(hydroxymethyl)but-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2/C=C(/C)[C@H](CO)C/C=C(/C)C[C@@H](OC(=O)/C(=C/CO)CO)[C@@H]12 |
| InChI | InChI=1S/C21H28O7/c1-12-4-5-15(10-23)13(2)9-18-19(14(3)20(25)27-18)17(8-12)28-21(26)16(11-24)6-7-22/h4,6,9,15,17-19,22-24H,3,5,7-8,10-11H2,1-2H3/b12-4-,13-9-,16-6+/t15-,17+,18-,19+/m0/s1 |
| InChIKey | SHOYICCSUKVOSJ-JBBNXKONSA-N |
| XLogP | 1.20 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|