C22H25NO2 — CID 44582899
N-[2-(7-methoxy-3-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]prop-2-enamide (PubChem CID 44582899) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[2-(7-methoxy-3-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]prop-2-enamide.
| Compound Name | N-[2-(7-methoxy-3-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 44582899 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N-[2-(7-methoxy-3-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC1CC(c2ccccc2)Cc2ccc(OC)cc21 |
| InChI | InChI=1S/C22H25NO2/c1-3-22(24)23-12-11-18-14-19(16-7-5-4-6-8-16)13-17-9-10-20(25-2)15-21(17)18/h3-10,15,18-19H,1,11-14H2,2H3,(H,23,24) |
| InChIKey | IWXZDJPJSBPQPA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|