C17H28N2 — CID 44582978
2-dec-9-enyl-4,5,6,7-tetrahydro-1H-benzimidazole (PubChem CID 44582978) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 2-dec-9-enyl-4,5,6,7-tetrahydro-1H-benzimidazole.
| Compound Name | 2-dec-9-enyl-4,5,6,7-tetrahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 44582978 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 2-dec-9-enyl-4,5,6,7-tetrahydro-1H-benzimidazole |
| SMILES | C=CCCCCCCCCc1nc2c([nH]1)CCCC2 |
| InChI | InChI=1S/C17H28N2/c1-2-3-4-5-6-7-8-9-14-17-18-15-12-10-11-13-16(15)19-17/h2H,1,3-14H2,(H,18,19) |
| InChIKey | RFEDMUHURNUEHP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|