C16H19N3OS — CID 44583171
(11S)-11-methyl-10-(2-methylprop-1-enyl)-2-sulfanylidene-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-7-carbaldehyde (PubChem CID 44583171) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is (11S)-11-methyl-10-(2-methylprop-1-enyl)-2-sulfanylidene-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-7-carbaldehyde.
| Compound Name | (11S)-11-methyl-10-(2-methylprop-1-enyl)-2-sulfanylidene-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-7-carbaldehyde |
|---|---|
| PubChem CID | 44583171 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (11S)-11-methyl-10-(2-methylprop-1-enyl)-2-sulfanylidene-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-7-carbaldehyde |
| SMILES | CC(C)=CN1Cc2c(C=O)ccc3[nH]c(=S)n(c23)C[C@@H]1C |
| InChI | InChI=1S/C16H19N3OS/c1-10(2)6-18-8-13-12(9-20)4-5-14-15(13)19(7-11(18)3)16(21)17-14/h4-6,9,11H,7-8H2,1-3H3,(H,17,21)/t11-/m0/s1 |
| InChIKey | BWGKXTTXRCYXJQ-NSHDSACASA-N |
| XLogP | 3.64 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|