About N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide
N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide (PubChem CID 44583277) has the molecular formula C23H22N4O2
and a molecular weight of 386.46 g/mol. Its IUPAC name is N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide.
Molecular Properties
| Compound Name | N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide |
| PubChem CID | 44583277 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide |
| SMILES | O=C(Nc1cnc(-c2ccccc2)cn1)N1CCC2(CC1)OCc1ccccc12 |
| InChI | InChI=1S/C23H22N4O2/c28-22(26-21-15-24-20(14-25-21)17-6-2-1-3-7-17)27-12-10-23(11-13-27)19-9-5-4-8-18(19)16-29-23/h1-9,14-15H,10-13,16H2,(H,25,26,28) |
| InChIKey | FUQBDKYELHXTHE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide?
The IUPAC name of N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide (CID 44583277) is N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide.
What is the SMILES notation for N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide?
The canonical SMILES for N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide is O=C(Nc1cnc(-c2ccccc2)cn1)N1CCC2(CC1)OCc1ccccc12.
What is the InChIKey of N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide?
The InChIKey is FUQBDKYELHXTHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O2/c28-22(26-21-15-24-20(14-25-21)17-6-2-1-3-7-17)27-12-10-23(11-13-27)19-9-5-4-8-18(19)16-29-23/h1-9,14-15H,10-13,16H2,(H,25,26,28).
What are the key properties of N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide?
N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide has a molecular weight of 386.46 g/mol, XLogP of 4.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-phenylpyrazin-2-yl)spiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxamide is sourced from PubChem (CID 44583277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).