About spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone
spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 44583353) has the molecular formula C21H20F3NO2
and a molecular weight of 375.39 g/mol. Its IUPAC name is spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone.
Molecular Properties
| Compound Name | spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone |
| PubChem CID | 44583353 |
| Molecular Formula | C21H20F3NO2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCC2(CCc3ccccc3O2)CC1 |
| InChI | InChI=1S/C21H20F3NO2/c22-21(23,24)17-7-5-16(6-8-17)19(26)25-13-11-20(12-14-25)10-9-15-3-1-2-4-18(15)27-20/h1-8H,9-14H2 |
| InChIKey | QYZZTCYPDDNZDI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone?
The IUPAC name of spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone (CID 44583353) is spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone.
What is the SMILES notation for spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone?
The canonical SMILES for spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone is O=C(c1ccc(C(F)(F)F)cc1)N1CCC2(CCc3ccccc3O2)CC1.
What is the InChIKey of spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone?
The InChIKey is QYZZTCYPDDNZDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F3NO2/c22-21(23,24)17-7-5-16(6-8-17)19(26)25-13-11-20(12-14-25)10-9-15-3-1-2-4-18(15)27-20/h1-8H,9-14H2.
What are the key properties of spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone?
spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone has a molecular weight of 375.39 g/mol, XLogP of 4.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl-[4-(trifluoromethyl)phenyl]methanone is sourced from PubChem (CID 44583353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).