C32H50FN3O7 — CID 44583366
(E)-but-2-enedioic acid;(3R)-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(1S)-1-(3-fluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxamide (PubChem CID 44583366) has the molecular formula C32H50FN3O7 and a molecular weight of 607.76 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(3R)-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(1S)-1-(3-fluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxamide.
| Compound Name | (E)-but-2-enedioic acid;(3R)-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(1S)-1-(3-fluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 44583366 |
| Molecular Formula | C32H50FN3O7 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.36 |
| IUPAC Name | (E)-but-2-enedioic acid;(3R)-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(1S)-1-(3-fluorophenyl)-1-hydroxy-5-methoxypentyl]piperidine-1-carboxamide |
| SMILES | CNC[C@H](CC1CCCCC1)NC(=O)N1CCC[C@@H]([C@@](O)(CCCCOC)c2cccc(F)c2)C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C28H46FN3O3.C4H4O4/c1-30-20-26(18-22-10-4-3-5-11-22)31-27(33)32-16-9-13-24(21-32)28(34,15-6-7-17-35-2)23-12-8-14-25(29)19-23;5-3(6)1-2-4(7)8/h8,12,14,19,22,24,26,30,34H,3-7,9-11,13,15-18,20-21H2,1-2H3,(H,31,33);1-2H,(H,5,6)(H,7,8)/b;2-1+/t24-,26+,28-;/m1./s1 |
| InChIKey | ZGOUUOBWTNHGQN-JBNHCFSZSA-N |
| XLogP | 4.52 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|