About 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide
3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide (PubChem CID 44583560) has the molecular formula C22H19N3O3S
and a molecular weight of 405.48 g/mol. Its IUPAC name is 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide.
Molecular Properties
| Compound Name | 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide |
| PubChem CID | 44583560 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide |
| SMILES | O=C1OC2(CCN(C(=O)Nc3nc(-c4ccccc4)cs3)CC2)c2ccccc21 |
| InChI | InChI=1S/C22H19N3O3S/c26-19-16-8-4-5-9-17(16)22(28-19)10-12-25(13-11-22)21(27)24-20-23-18(14-29-20)15-6-2-1-3-7-15/h1-9,14H,10-13H2,(H,23,24,27) |
| InChIKey | VUPDMJLETWSFDS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide?
The IUPAC name of 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide (CID 44583560) is 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide.
What is the SMILES notation for 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide?
The canonical SMILES for 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide is O=C1OC2(CCN(C(=O)Nc3nc(-c4ccccc4)cs3)CC2)c2ccccc21.
What is the InChIKey of 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide?
The InChIKey is VUPDMJLETWSFDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O3S/c26-19-16-8-4-5-9-17(16)22(28-19)10-12-25(13-11-22)21(27)24-20-23-18(14-29-20)15-6-2-1-3-7-15/h1-9,14H,10-13H2,(H,23,24,27).
What are the key properties of 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide?
3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide has a molecular weight of 405.48 g/mol, XLogP of 4.50, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-N-(4-phenyl-1,3-thiazol-2-yl)spiro[2-benzofuran-1,4'-piperidine]-1'-carboxamide is sourced from PubChem (CID 44583560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).