About [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea
[(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea (PubChem CID 44583572) has the molecular formula C14H11Cl2N3S
and a molecular weight of 324.24 g/mol. Its IUPAC name is [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea.
Molecular Properties
| Compound Name | [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea |
| PubChem CID | 44583572 |
| Molecular Formula | C14H11Cl2N3S |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea |
| SMILES | NC(=S)N/N=C(/c1ccccc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2N3S/c15-11-6-10(7-12(16)8-11)13(18-19-14(17)20)9-4-2-1-3-5-9/h1-8H,(H3,17,19,20)/b18-13- |
| InChIKey | PRUADTGZDMGCPX-AQTBWJFISA-N |
| XLogP | 3.58 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea?
The IUPAC name of [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea (CID 44583572) is [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea.
What is the SMILES notation for [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea?
The canonical SMILES for [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea is NC(=S)N/N=C(/c1ccccc1)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea?
The InChIKey is PRUADTGZDMGCPX-AQTBWJFISA-N. The full InChI is InChI=1S/C14H11Cl2N3S/c15-11-6-10(7-12(16)8-11)13(18-19-14(17)20)9-4-2-1-3-5-9/h1-8H,(H3,17,19,20)/b18-13-.
What are the key properties of [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea?
[(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea has a molecular weight of 324.24 g/mol, XLogP of 3.58, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[(3,5-dichlorophenyl)-phenylmethylidene]amino]thiourea is sourced from PubChem (CID 44583572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).