C30H23N3O2S — CID 44583599
2,6-bis(4-phenylmethoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazole (PubChem CID 44583599) has the molecular formula C30H23N3O2S and a molecular weight of 489.60 g/mol. Its IUPAC name is 2,6-bis(4-phenylmethoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazole.
| Compound Name | 2,6-bis(4-phenylmethoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 44583599 |
| Molecular Formula | C30H23N3O2S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2,6-bis(4-phenylmethoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazole |
| SMILES | c1ccc(COc2ccc(-c3nc4scc(-c5ccc(OCc6ccccc6)cc5)n4n3)cc2)cc1 |
| InChI | InChI=1S/C30H23N3O2S/c1-3-7-22(8-4-1)19-34-26-15-11-24(12-16-26)28-21-36-30-31-29(32-33(28)30)25-13-17-27(18-14-25)35-20-23-9-5-2-6-10-23/h1-18,21H,19-20H2 |
| InChIKey | HTAUKGYPEATILA-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |