C22H32O5 — CID 44583835
[(3R,4E,8E,11S,12R,13S)-3-hydroxy-5,9-dimethyl-15-oxo-12-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),4,8-trien-11-yl] acetate (PubChem CID 44583835) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(3R,4E,8E,11S,12R,13S)-3-hydroxy-5,9-dimethyl-15-oxo-12-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),4,8-trien-11-yl] acetate.
| Compound Name | [(3R,4E,8E,11S,12R,13S)-3-hydroxy-5,9-dimethyl-15-oxo-12-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),4,8-trien-11-yl] acetate |
|---|---|
| PubChem CID | 44583835 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(3R,4E,8E,11S,12R,13S)-3-hydroxy-5,9-dimethyl-15-oxo-12-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),4,8-trien-11-yl] acetate |
| SMILES | CC(=O)O[C@H]1C/C(C)=C/CC/C(C)=C/[C@H](O)CC2=C[C@H](OC2=O)[C@@H]1C(C)C |
| InChI | InChI=1S/C22H32O5/c1-13(2)21-19(26-16(5)23)10-15(4)8-6-7-14(3)9-18(24)11-17-12-20(21)27-22(17)25/h8-9,12-13,18-21,24H,6-7,10-11H2,1-5H3/b14-9+,15-8+/t18-,19-,20-,21+/m0/s1 |
| InChIKey | CBPIZTNTZKKYKN-CANJYTBCSA-N |
| XLogP | 3.87 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|