About Leucasperol (A/B)
Leucasperol (A/B) (PubChem CID 44583853) has the molecular formula C20H32O5
and a molecular weight of 352.47 g/mol.
Molecular Properties
| Compound Name | Leucasperol (A/B) |
| PubChem CID | 44583853 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | — |
| SMILES | C[C@@H]1CC(=O)[C@H]2C(C)(C)[C@@H](O)CC[C@]2(C)[C@@]12CC[C@@]1(CCOC1O)O2 |
| InChI | InChI=1S/C20H32O5/c1-12-11-13(21)15-17(2,3)14(22)5-6-18(15,4)20(12)8-7-19(25-20)9-10-24-16(19)23/h12,14-16,22-23H,5-11H2,1-4H3/t12-,14+,15+,16?,18+,19+,20-/m1/s1 |
| InChIKey | PITIZJDONNHGKA-OMTRXLGISA-N |
| XLogP | 2.43 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Leucasperol (A/B) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Leucasperol (A/B)?
The IUPAC name of Leucasperol (A/B) (CID 44583853) is not available.
What is the SMILES notation for Leucasperol (A/B)?
The canonical SMILES for Leucasperol (A/B) is C[C@@H]1CC(=O)[C@H]2C(C)(C)[C@@H](O)CC[C@]2(C)[C@@]12CC[C@@]1(CCOC1O)O2.
What is the InChIKey of Leucasperol (A/B)?
The InChIKey is PITIZJDONNHGKA-OMTRXLGISA-N. The full InChI is InChI=1S/C20H32O5/c1-12-11-13(21)15-17(2,3)14(22)5-6-18(15,4)20(12)8-7-19(25-20)9-10-24-16(19)23/h12,14-16,22-23H,5-11H2,1-4H3/t12-,14+,15+,16?,18+,19+,20-/m1/s1.
What are the key properties of Leucasperol (A/B)?
Leucasperol (A/B) has a molecular weight of 352.47 g/mol, XLogP of 2.43, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Leucasperol (A/B) is sourced from PubChem (CID 44583853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).