C16H22NO2+ — CID 44583887
(5S,6R)-6-[(8aS)-2,3,4,5,6,8a-hexahydro-1H-indolizin-4-ium-8-carbonyl]-5-methylcyclohex-2-en-1-one (PubChem CID 44583887) has the molecular formula C16H22NO2+ and a molecular weight of 260.36 g/mol. Its IUPAC name is (5S,6R)-6-[(8aS)-2,3,4,5,6,8a-hexahydro-1H-indolizin-4-ium-8-carbonyl]-5-methylcyclohex-2-en-1-one.
| Compound Name | (5S,6R)-6-[(8aS)-2,3,4,5,6,8a-hexahydro-1H-indolizin-4-ium-8-carbonyl]-5-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 44583887 |
| Molecular Formula | C16H22NO2+ |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (5S,6R)-6-[(8aS)-2,3,4,5,6,8a-hexahydro-1H-indolizin-4-ium-8-carbonyl]-5-methylcyclohex-2-en-1-one |
| SMILES | C[C@H]1CC=CC(=O)[C@@H]1C(=O)C1=CCC[NH+]2CCC[C@@H]12 |
| InChI | InChI=1S/C16H21NO2/c1-11-5-2-8-14(18)15(11)16(19)12-6-3-9-17-10-4-7-13(12)17/h2,6,8,11,13,15H,3-5,7,9-10H2,1H3/p+1/t11-,13-,15+/m0/s1 |
| InChIKey | FKYCJVGMJYUVIJ-CORIIIEPSA-O |
| XLogP | 0.71 |
| TPSA | 38.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|