C15H26O4 — CID 44583979
(1R,2R,5R,6R,7Z,10S)-7-methyl-3-methylidene-10-propan-2-ylcyclodec-7-ene-1,2,5,6-tetrol (PubChem CID 44583979) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1R,2R,5R,6R,7Z,10S)-7-methyl-3-methylidene-10-propan-2-ylcyclodec-7-ene-1,2,5,6-tetrol.
| Compound Name | (1R,2R,5R,6R,7Z,10S)-7-methyl-3-methylidene-10-propan-2-ylcyclodec-7-ene-1,2,5,6-tetrol |
|---|---|
| PubChem CID | 44583979 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (1R,2R,5R,6R,7Z,10S)-7-methyl-3-methylidene-10-propan-2-ylcyclodec-7-ene-1,2,5,6-tetrol |
| SMILES | C=C1C[C@@H](O)[C@H](O)/C(C)=C\C[C@@H](C(C)C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H26O4/c1-8(2)11-6-5-9(3)13(17)12(16)7-10(4)14(18)15(11)19/h5,8,11-19H,4,6-7H2,1-3H3/b9-5-/t11-,12+,13+,14+,15+/m0/s1 |
| InChIKey | PTFYPQCJYOKIDY-BUMDVPOKSA-N |
| XLogP | 1.00 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|