C18H26O5 — CID 44584012
(1R,3S,4S,7S)-7-ethoxy-5-[(E)-hex-4-enoyl]-3,6-dihydroxy-1,3-dimethylbicyclo[2.2.2]oct-5-en-2-one (PubChem CID 44584012) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is (1R,3S,4S,7S)-7-ethoxy-5-[(E)-hex-4-enoyl]-3,6-dihydroxy-1,3-dimethylbicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1R,3S,4S,7S)-7-ethoxy-5-[(E)-hex-4-enoyl]-3,6-dihydroxy-1,3-dimethylbicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 44584012 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (1R,3S,4S,7S)-7-ethoxy-5-[(E)-hex-4-enoyl]-3,6-dihydroxy-1,3-dimethylbicyclo[2.2.2]oct-5-en-2-one |
| SMILES | C/C=C/CCC(=O)C1=C(O)[C@]2(C)C(=O)[C@@](C)(O)[C@H]1C[C@@H]2OCC |
| InChI | InChI=1S/C18H26O5/c1-5-7-8-9-12(19)14-11-10-13(23-6-2)17(3,15(14)20)16(21)18(11,4)22/h5,7,11,13,20,22H,6,8-10H2,1-4H3/b7-5+/t11-,13-,17+,18-/m0/s1 |
| InChIKey | YIEIUNLELXQYRP-ZKCCSTIESA-N |
| XLogP | 2.49 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|