C28H44O7 — CID 44584038
[(1S,3S,6R,7S,8R,9R)-3-[(2R,6S)-6-[(1S,4aS,8aR)-4,7-dimethyl-1,2,4a,5,6,8a-hexahydronaphthalen-1-yl]heptan-2-yl]-8,9-dihydroxy-2,4,10-trioxabicyclo[4.3.1]decan-7-yl] acetate (PubChem CID 44584038) has the molecular formula C28H44O7 and a molecular weight of 492.65 g/mol. Its IUPAC name is [(1S,3S,6R,7S,8R,9R)-3-[(2R,6S)-6-[(1S,4aS,8aR)-4,7-dimethyl-1,2,4a,5,6,8a-hexahydronaphthalen-1-yl]heptan-2-yl]-8,9-dihydroxy-2,4,10-trioxabicyclo[4.3.1]decan-7-yl] acetate.
| Compound Name | [(1S,3S,6R,7S,8R,9R)-3-[(2R,6S)-6-[(1S,4aS,8aR)-4,7-dimethyl-1,2,4a,5,6,8a-hexahydronaphthalen-1-yl]heptan-2-yl]-8,9-dihydroxy-2,4,10-trioxabicyclo[4.3.1]decan-7-yl] acetate |
|---|---|
| PubChem CID | 44584038 |
| Molecular Formula | C28H44O7 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | [(1S,3S,6R,7S,8R,9R)-3-[(2R,6S)-6-[(1S,4aS,8aR)-4,7-dimethyl-1,2,4a,5,6,8a-hexahydronaphthalen-1-yl]heptan-2-yl]-8,9-dihydroxy-2,4,10-trioxabicyclo[4.3.1]decan-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O)[C@@H](O)[C@@H]2O[C@@H]([C@H](C)CCC[C@H](C)[C@@H]3CC=C(C)[C@H]4CCC(C)=C[C@@H]34)OC[C@H]1O2 |
| InChI | InChI=1S/C28H44O7/c1-15-9-11-20-17(3)10-12-21(22(20)13-15)16(2)7-6-8-18(4)27-32-14-23-26(33-19(5)29)24(30)25(31)28(34-23)35-27/h10,13,16,18,20-28,30-31H,6-9,11-12,14H2,1-5H3/t16-,18+,20+,21-,22+,23+,24+,25+,26+,27-,28-/m0/s1 |
| InChIKey | UNPUXBUKESCWCN-KTVYGYCHSA-N |
| XLogP | 4.12 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|