About [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate
[(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate (PubChem CID 44584048) has the molecular formula C23H40O4
and a molecular weight of 380.57 g/mol. Its IUPAC name is [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate.
Molecular Properties
| Compound Name | [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate |
| PubChem CID | 44584048 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)CC(CO)OC(C)=O |
| InChI | InChI=1S/C23H40O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(26)19-23(20-24)27-21(2)25/h7-8,10-11,23-24H,3-6,9,12-20H2,1-2H3/b8-7-,11-10- |
| InChIKey | ZAIRPZJGPNIHRZ-NQLNTKRDSA-N |
| XLogP | 5.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate?
The IUPAC name of [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate (CID 44584048) is [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate.
What is the SMILES notation for [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate?
The canonical SMILES for [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate is CCCCC/C=C\C/C=C\CCCCCCCC(=O)CC(CO)OC(C)=O.
What is the InChIKey of [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate?
The InChIKey is ZAIRPZJGPNIHRZ-NQLNTKRDSA-N. The full InChI is InChI=1S/C23H40O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(26)19-23(20-24)27-21(2)25/h7-8,10-11,23-24H,3-6,9,12-20H2,1-2H3/b8-7-,11-10-.
What are the key properties of [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate?
[(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate has a molecular weight of 380.57 g/mol, XLogP of 5.68, 18 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(12Z,15Z)-1-hydroxy-4-oxohenicosa-12,15-dien-2-yl] acetate is sourced from PubChem (CID 44584048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).