C19H15NO8 — CID 44584157
2-[(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)methylamino]butanedioic acid (PubChem CID 44584157) has the molecular formula C19H15NO8 and a molecular weight of 385.33 g/mol. Its IUPAC name is 2-[(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)methylamino]butanedioic acid.
| Compound Name | 2-[(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)methylamino]butanedioic acid |
|---|---|
| PubChem CID | 44584157 |
| Molecular Formula | C19H15NO8 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-[(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)methylamino]butanedioic acid |
| SMILES | O=C(O)CC(NCc1cc2c(c(O)c1O)C(=O)c1ccccc1C2=O)C(=O)O |
| InChI | InChI=1S/C19H15NO8/c21-13(22)6-12(19(27)28)20-7-8-5-11-14(18(26)15(8)23)17(25)10-4-2-1-3-9(10)16(11)24/h1-5,12,20,23,26H,6-7H2,(H,21,22)(H,27,28) |
| InChIKey | BLBNHNDBZQTJNT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|