C30H46O6 — CID 44584183
(1R,2S,4S,5R,8R,9R,10R,11S,13R,14R,18R,21S)-2,10,11-trihydroxy-9-(hydroxymethyl)-4,5,9,13,20,20-hexamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one (PubChem CID 44584183) has the molecular formula C30H46O6 and a molecular weight of 502.69 g/mol. Its IUPAC name is (1R,2S,4S,5R,8R,9R,10R,11S,13R,14R,18R,21S)-2,10,11-trihydroxy-9-(hydroxymethyl)-4,5,9,13,20,20-hexamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one.
| Compound Name | (1R,2S,4S,5R,8R,9R,10R,11S,13R,14R,18R,21S)-2,10,11-trihydroxy-9-(hydroxymethyl)-4,5,9,13,20,20-hexamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one |
|---|---|
| PubChem CID | 44584183 |
| Molecular Formula | C30H46O6 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | (1R,2S,4S,5R,8R,9R,10R,11S,13R,14R,18R,21S)-2,10,11-trihydroxy-9-(hydroxymethyl)-4,5,9,13,20,20-hexamethyl-22-oxahexacyclo[19.2.1.01,18.04,17.05,14.08,13]tetracos-16-en-23-one |
| SMILES | CC1(C)C[C@@H]2C3=CC[C@@H]4[C@@]5(C)C[C@H](O)[C@H](O)[C@@](C)(CO)[C@@H]5CC[C@@]4(C)[C@]3(C)C[C@H](O)[C@@]23C[C@@H]1OC3=O |
| InChI | InChI=1S/C30H46O6/c1-25(2)11-17-16-7-8-20-26(3)12-18(32)23(34)27(4,15-31)19(26)9-10-28(20,5)29(16,6)13-21(33)30(17)14-22(25)36-24(30)35/h7,17-23,31-34H,8-15H2,1-6H3/t17-,18+,19-,20-,21+,22+,23+,26+,27+,28-,29-,30-/m1/s1 |
| InChIKey | VIAAIAAZKPRCJO-AUNCNNHTSA-N |
| XLogP | 3.60 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|