C26H36O10 — CID 44584198
[(1S,2R,3R,4R,7S,8Z,10R,12R,13R,14S)-10,12-diacetyloxy-2,3-dihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-14-yl] acetate (PubChem CID 44584198) has the molecular formula C26H36O10 and a molecular weight of 508.56 g/mol. Its IUPAC name is [(1S,2R,3R,4R,7S,8Z,10R,12R,13R,14S)-10,12-diacetyloxy-2,3-dihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-14-yl] acetate.
| Compound Name | [(1S,2R,3R,4R,7S,8Z,10R,12R,13R,14S)-10,12-diacetyloxy-2,3-dihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-14-yl] acetate |
|---|---|
| PubChem CID | 44584198 |
| Molecular Formula | C26H36O10 |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | [(1S,2R,3R,4R,7S,8Z,10R,12R,13R,14S)-10,12-diacetyloxy-2,3-dihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC=C(C)[C@@H]2[C@@H](O)[C@@]3(O)[C@H](/C=C(/C)[C@H](OC(C)=O)C[C@@H](OC(C)=O)[C@@]12C)OC(=O)[C@@H]3C |
| InChI | InChI=1S/C26H36O10/c1-12-8-9-19(34-16(5)28)25(7)20(35-17(6)29)11-18(33-15(4)27)13(2)10-21-26(32,23(30)22(12)25)14(3)24(31)36-21/h8,10,14,18-23,30,32H,9,11H2,1-7H3/b13-10-/t14-,18+,19-,20+,21-,22+,23+,25+,26-/m0/s1 |
| InChIKey | ICLRQQSDLHKALI-RMSZVCEZSA-N |
| XLogP | 1.76 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|