C26H36O9 — CID 44584202
[(1S,2R,3S,4R,7S,8Z,12R,13S,14S)-2,14-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] acetate (PubChem CID 44584202) has the molecular formula C26H36O9 and a molecular weight of 492.57 g/mol. Its IUPAC name is [(1S,2R,3S,4R,7S,8Z,12R,13S,14S)-2,14-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] acetate.
| Compound Name | [(1S,2R,3S,4R,7S,8Z,12R,13S,14S)-2,14-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] acetate |
|---|---|
| PubChem CID | 44584202 |
| Molecular Formula | C26H36O9 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | [(1S,2R,3S,4R,7S,8Z,12R,13S,14S)-2,14-diacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC=C(C)[C@@H]2[C@@H](OC(C)=O)[C@@]3(O)[C@H](/C=C(/C)CC[C@@H](OC(C)=O)[C@@]12C)OC(=O)[C@@H]3C |
| InChI | InChI=1S/C26H36O9/c1-13-8-10-19(32-16(4)27)25(7)20(33-17(5)28)11-9-14(2)22(25)23(34-18(6)29)26(31)15(3)24(30)35-21(26)12-13/h9,12,15,19-23,31H,8,10-11H2,1-7H3/b13-12-/t15-,19+,20-,21-,22+,23+,25-,26-/m0/s1 |
| InChIKey | NQDFQEWZRXRFKA-KNHVTUJWSA-N |
| XLogP | 2.79 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|