C20H31NS — CID 44584208
(1R,4S,4aS,8aR)-4-isothiocyanato-4-methyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,4a,5,6,8a-hexahydro-1H-naphthalene (PubChem CID 44584208) has the molecular formula C20H31NS and a molecular weight of 317.54 g/mol. Its IUPAC name is (1R,4S,4aS,8aR)-4-isothiocyanato-4-methyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,4a,5,6,8a-hexahydro-1H-naphthalene.
| Compound Name | (1R,4S,4aS,8aR)-4-isothiocyanato-4-methyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,4a,5,6,8a-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 44584208 |
| Molecular Formula | C20H31NS |
| Molecular Weight | 317.54 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | (1R,4S,4aS,8aR)-4-isothiocyanato-4-methyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,4a,5,6,8a-hexahydro-1H-naphthalene |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC[C@](C)(N=C=S)[C@H]2CCC=C[C@H]12 |
| InChI | InChI=1S/C20H31NS/c1-15(2)8-7-9-16(3)17-12-13-20(4,21-14-22)19-11-6-5-10-18(17)19/h5,8,10,16-19H,6-7,9,11-13H2,1-4H3/t16-,17-,18-,19+,20+/m1/s1 |
| InChIKey | KZXDVJJOMQYNRC-UEDWAMCQSA-N |
| XLogP | 6.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|