C20H32O3 — CID 44584304
(4R,5S,7E,9Z,14R)-5-hydroxy-4,10,14-trimethyl-7-propan-2-ylcyclotetradeca-7,9-diene-1,6-dione (PubChem CID 44584304) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (4R,5S,7E,9Z,14R)-5-hydroxy-4,10,14-trimethyl-7-propan-2-ylcyclotetradeca-7,9-diene-1,6-dione.
| Compound Name | (4R,5S,7E,9Z,14R)-5-hydroxy-4,10,14-trimethyl-7-propan-2-ylcyclotetradeca-7,9-diene-1,6-dione |
|---|---|
| PubChem CID | 44584304 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (4R,5S,7E,9Z,14R)-5-hydroxy-4,10,14-trimethyl-7-propan-2-ylcyclotetradeca-7,9-diene-1,6-dione |
| SMILES | C/C1=C/C=C(\C(C)C)C(=O)[C@@H](O)[C@H](C)CCC(=O)[C@H](C)CCC1 |
| InChI | InChI=1S/C20H32O3/c1-13(2)17-11-9-14(3)7-6-8-15(4)18(21)12-10-16(5)19(22)20(17)23/h9,11,13,15-16,19,22H,6-8,10,12H2,1-5H3/b14-9-,17-11+/t15-,16-,19+/m1/s1 |
| InChIKey | OOFMLGJXGLLNQD-CDRYJJKHSA-N |
| XLogP | 4.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |