C28H22O4 — CID 44584308
(8E)-2,16-dioxapentacyclo[22.2.2.13,7.117,21.010,15]triaconta-1(26),3,5,7(30),8,10(15),11,13,17,19,21(29),24,27-tridecaene-4,12-diol (PubChem CID 44584308) has the molecular formula C28H22O4 and a molecular weight of 422.48 g/mol. Its IUPAC name is (8E)-2,16-dioxapentacyclo[22.2.2.13,7.117,21.010,15]triaconta-1(26),3,5,7(30),8,10(15),11,13,17,19,21(29),24,27-tridecaene-4,12-diol.
| Compound Name | (8E)-2,16-dioxapentacyclo[22.2.2.13,7.117,21.010,15]triaconta-1(26),3,5,7(30),8,10(15),11,13,17,19,21(29),24,27-tridecaene-4,12-diol |
|---|---|
| PubChem CID | 44584308 |
| Molecular Formula | C28H22O4 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (8E)-2,16-dioxapentacyclo[22.2.2.13,7.117,21.010,15]triaconta-1(26),3,5,7(30),8,10(15),11,13,17,19,21(29),24,27-tridecaene-4,12-diol |
| SMILES | Oc1ccc2c(c1)/C=C\c1ccc(O)c(c1)Oc1ccc(cc1)CCc1cccc(c1)O2 |
| InChI | InChI=1S/C28H22O4/c29-23-11-15-27-22(18-23)10-6-21-9-14-26(30)28(17-21)31-24-12-7-19(8-13-24)4-5-20-2-1-3-25(16-20)32-27/h1-3,6-18,29-30H,4-5H2/b10-6- |
| InChIKey | MOTBWTKNDKAKBC-POHAHGRESA-N |
| XLogP | 6.95 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|