C9H12O6 — CID 44584321
acetic acid;(1R,5R,6R)-5-hydroxy-3-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 44584321) has the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. Its IUPAC name is acetic acid;(1R,5R,6R)-5-hydroxy-3-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | acetic acid;(1R,5R,6R)-5-hydroxy-3-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 44584321 |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | acetic acid;(1R,5R,6R)-5-hydroxy-3-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(=O)O.O=C1C(CO)=C[C@@H](O)[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C7H8O4.C2H4O2/c8-2-3-1-4(9)6-7(11-6)5(3)10;1-2(3)4/h1,4,6-9H,2H2;1H3,(H,3,4)/t4-,6-,7+;/m1./s1 |
| InChIKey | GPCPCQCABXPDQJ-ZWKSQQCZSA-N |
| XLogP | -1.29 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|