C23H40O6 — CID 44584379
(3R,5R)-7-[(1S,2S,4aR,8S,8aS)-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 44584379) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is (3R,5R)-7-[(1S,2S,4aR,8S,8aS)-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[(1S,2S,4aR,8S,8aS)-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 44584379 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (3R,5R)-7-[(1S,2S,4aR,8S,8aS)-2-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CC[C@H](C)C(=O)O[C@H]1CCC[C@@H]2CC[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(=O)O)[C@H]21 |
| InChI | InChI=1S/C23H40O6/c1-4-14(2)23(28)29-20-7-5-6-16-9-8-15(3)19(22(16)20)11-10-17(24)12-18(25)13-21(26)27/h14-20,22,24-25H,4-13H2,1-3H3,(H,26,27)/t14-,15-,16+,17+,18+,19-,20-,22-/m0/s1 |
| InChIKey | CHWCXTAKZKUCIZ-CGDGMRKMSA-N |
| XLogP | 3.77 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |