C28H38O13 — CID 44584464
[(1S,2R,3S,4R,5R,6R,7R,8R,9R,10R,12Z,14S,17R)-2,7,9-triacetyloxy-5,6-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-10-yl] acetate (PubChem CID 44584464) has the molecular formula C28H38O13 and a molecular weight of 582.60 g/mol. Its IUPAC name is [(1S,2R,3S,4R,5R,6R,7R,8R,9R,10R,12Z,14S,17R)-2,7,9-triacetyloxy-5,6-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-10-yl] acetate.
| Compound Name | [(1S,2R,3S,4R,5R,6R,7R,8R,9R,10R,12Z,14S,17R)-2,7,9-triacetyloxy-5,6-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-10-yl] acetate |
|---|---|
| PubChem CID | 44584464 |
| Molecular Formula | C28H38O13 |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | [(1S,2R,3S,4R,5R,6R,7R,8R,9R,10R,12Z,14S,17R)-2,7,9-triacetyloxy-5,6-dihydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-10-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2[C@@H](C)[C@@H](O)[C@@H](O)[C@H](OC(C)=O)[C@]2(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)C/C(C)=C\[C@@H]2OC(=O)[C@]3(C)O[C@@]213 |
| InChI | InChI=1S/C28H38O13/c1-11-9-17(36-13(3)29)22(37-14(4)30)26(7)19(12(2)20(33)21(34)24(26)39-16(6)32)23(38-15(5)31)28-18(10-11)40-25(35)27(28,8)41-28/h10,12,17-24,33-34H,9H2,1-8H3/b11-10-/t12-,17-,18+,19-,20-,21-,22+,23-,24+,26+,27+,28+/m1/s1 |
| InChIKey | HFHZNPVUUCLYRO-FAOYVRFFSA-N |
| XLogP | 0.51 |
| TPSA | 184.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.60 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|