C26H34O7 — CID 44584510
[(1S,2R,5S,6S,7S,9R,12R)-5,12-diacetyloxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate (PubChem CID 44584510) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is [(1S,2R,5S,6S,7S,9R,12R)-5,12-diacetyloxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate.
| Compound Name | [(1S,2R,5S,6S,7S,9R,12R)-5,12-diacetyloxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate |
|---|---|
| PubChem CID | 44584510 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | [(1S,2R,5S,6S,7S,9R,12R)-5,12-diacetyloxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate |
| SMILES | CC(=O)O[C@H]1CC[C@@H](C)[C@]23OC(C)(C)[C@H](C[C@H](OC(=O)c4ccccc4)[C@]12C)[C@H]3OC(C)=O |
| InChI | InChI=1S/C26H34O7/c1-15-12-13-20(30-16(2)27)25(6)21(32-23(29)18-10-8-7-9-11-18)14-19-22(31-17(3)28)26(15,25)33-24(19,4)5/h7-11,15,19-22H,12-14H2,1-6H3/t15-,19-,20+,21+,22-,25+,26-/m1/s1 |
| InChIKey | DDIPYHPAIWOAAM-BFHJBHDXSA-N |
| XLogP | 4.08 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|