C20H31NaO3 — CID 44584589
sodium (2S,7Z)-2-methoxy-12-methyloctadeca-7,17-dien-5-ynoate (PubChem CID 44584589) has the molecular formula C20H31NaO3 and a molecular weight of 342.46 g/mol. Its IUPAC name is sodium (2S,7Z)-2-methoxy-12-methyloctadeca-7,17-dien-5-ynoate.
| Compound Name | sodium (2S,7Z)-2-methoxy-12-methyloctadeca-7,17-dien-5-ynoate |
|---|---|
| PubChem CID | 44584589 |
| Molecular Formula | C20H31NaO3 |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | sodium (2S,7Z)-2-methoxy-12-methyloctadeca-7,17-dien-5-ynoate |
| SMILES | C=CCCCCC(C)CCC/C=C\C#CCC[C@H](OC)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H32O3.Na/c1-4-5-6-12-15-18(2)16-13-10-8-7-9-11-14-17-19(23-3)20(21)22;/h4,7-8,18-19H,1,5-6,10,12-17H2,2-3H3,(H,21,22);/q;+1/p-1/b8-7-;/t18?,19-;/m0./s1 |
| InChIKey | RLSXKIUQYFNFBI-PJZMSVRGSA-M |
| XLogP | 0.65 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|