C18H19NO6 — CID 44584644
1,2,3,5,6-pentamethoxy-10H-acridin-9-one (PubChem CID 44584644) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is 1,2,3,5,6-pentamethoxy-10H-acridin-9-one.
| Compound Name | 1,2,3,5,6-pentamethoxy-10H-acridin-9-one |
|---|---|
| PubChem CID | 44584644 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1,2,3,5,6-pentamethoxy-10H-acridin-9-one |
| SMILES | COc1cc2[nH]c3c(OC)c(OC)ccc3c(=O)c2c(OC)c1OC |
| InChI | InChI=1S/C18H19NO6/c1-21-11-7-6-9-14(16(11)23-3)19-10-8-12(22-2)17(24-4)18(25-5)13(10)15(9)20/h6-8H,1-5H3,(H,19,20) |
| InChIKey | CCYFNSHESGHUKB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|