C22H36O3 — CID 44584713
[(6E,8R,10E,14E)-16-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] acetate (PubChem CID 44584713) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is [(6E,8R,10E,14E)-16-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] acetate.
| Compound Name | [(6E,8R,10E,14E)-16-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] acetate |
|---|---|
| PubChem CID | 44584713 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | [(6E,8R,10E,14E)-16-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] acetate |
| SMILES | CC(=O)O[C@@H](/C=C(\C)CCC=C(C)C)C/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C22H36O3/c1-17(2)9-7-11-19(4)15-22(25-21(6)24)16-20(5)12-8-10-18(3)13-14-23/h9,12-13,15,22-23H,7-8,10-11,14,16H2,1-6H3/b18-13+,19-15+,20-12+/t22-/m0/s1 |
| InChIKey | LDGUVHWDRNJSCF-NOCSFPBJSA-N |
| XLogP | 5.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|