C28H40O13 — CID 44584762
[(1S,2R,3R,4R,7S,8Z,11S,12R,13R,14S,16S,17R)-2,11,12-triacetyloxy-3,4,16-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] acetate (PubChem CID 44584762) has the molecular formula C28H40O13 and a molecular weight of 584.62 g/mol. Its IUPAC name is [(1S,2R,3R,4R,7S,8Z,11S,12R,13R,14S,16S,17R)-2,11,12-triacetyloxy-3,4,16-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] acetate.
| Compound Name | [(1S,2R,3R,4R,7S,8Z,11S,12R,13R,14S,16S,17R)-2,11,12-triacetyloxy-3,4,16-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] acetate |
|---|---|
| PubChem CID | 44584762 |
| Molecular Formula | C28H40O13 |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | [(1S,2R,3R,4R,7S,8Z,11S,12R,13R,14S,16S,17R)-2,11,12-triacetyloxy-3,4,16-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1C/C(C)=C\[C@@H]2OC(=O)[C@](C)(O)[C@]2(O)[C@H](OC(C)=O)[C@H]2[C@@H](C)[C@@H](O)C[C@H](OC(C)=O)[C@]2(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H40O13/c1-12-9-19(37-14(3)29)23(39-16(5)31)26(7)20(38-15(4)30)11-18(33)13(2)22(26)24(40-17(6)32)28(36)21(10-12)41-25(34)27(28,8)35/h10,13,18-24,33,35-36H,9,11H2,1-8H3/b12-10-/t13-,18-,19-,20-,21-,22+,23-,24+,26-,27-,28+/m0/s1 |
| InChIKey | ZHECUSALRKIRAJ-FJHCLNPXSA-N |
| XLogP | 0.49 |
| TPSA | 192.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|