C30H44O13 — CID 44584763
[(1S,2R,3R,4R,7S,8Z,11S,12R,13R,14S,16S,17R)-2,12,14-triacetyloxy-3,4,16-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-11-yl] butanoate (PubChem CID 44584763) has the molecular formula C30H44O13 and a molecular weight of 612.67 g/mol. Its IUPAC name is [(1S,2R,3R,4R,7S,8Z,11S,12R,13R,14S,16S,17R)-2,12,14-triacetyloxy-3,4,16-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-11-yl] butanoate.
| Compound Name | [(1S,2R,3R,4R,7S,8Z,11S,12R,13R,14S,16S,17R)-2,12,14-triacetyloxy-3,4,16-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-11-yl] butanoate |
|---|---|
| PubChem CID | 44584763 |
| Molecular Formula | C30H44O13 |
| Molecular Weight | 612.67 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | [(1S,2R,3R,4R,7S,8Z,11S,12R,13R,14S,16S,17R)-2,12,14-triacetyloxy-3,4,16-trihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-en-11-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1C/C(C)=C\[C@@H]2OC(=O)[C@](C)(O)[C@]2(O)[C@H](OC(C)=O)[C@H]2[C@@H](C)[C@@H](O)C[C@H](OC(C)=O)[C@]2(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H44O13/c1-9-10-23(35)42-20-11-14(2)12-22-30(38,29(8,37)27(36)43-22)26(41-18(6)33)24-15(3)19(34)13-21(39-16(4)31)28(24,7)25(20)40-17(5)32/h12,15,19-22,24-26,34,37-38H,9-11,13H2,1-8H3/b14-12-/t15-,19-,20-,21-,22-,24+,25-,26+,28-,29-,30+/m0/s1 |
| InChIKey | ZSLFBBPCCHJUKI-ZPADSBQXSA-N |
| XLogP | 1.27 |
| TPSA | 192.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.67 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|