C23H38O4 — CID 44584775
(2S)-2-[(3R,6S)-6-[2-[(1S,2R,4aR,8aR)-2,4a-dimethyl-5-methylidene-1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid (PubChem CID 44584775) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is (2S)-2-[(3R,6S)-6-[2-[(1S,2R,4aR,8aR)-2,4a-dimethyl-5-methylidene-1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid.
| Compound Name | (2S)-2-[(3R,6S)-6-[2-[(1S,2R,4aR,8aR)-2,4a-dimethyl-5-methylidene-1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 44584775 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | (2S)-2-[(3R,6S)-6-[2-[(1S,2R,4aR,8aR)-2,4a-dimethyl-5-methylidene-1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid |
| SMILES | C=C1CCC[C@@H]2[C@@H](CC[C@@]3(C)CC[C@H]([C@H](C)C(=O)O)OO3)[C@H](C)CC[C@@]12C |
| InChI | InChI=1S/C23H38O4/c1-15-9-14-23(5)16(2)7-6-8-19(23)18(15)10-12-22(4)13-11-20(26-27-22)17(3)21(24)25/h15,17-20H,2,6-14H2,1,3-5H3,(H,24,25)/t15-,17+,18+,19-,20-,22+,23+/m1/s1 |
| InChIKey | VRMMLZKUQZCNHU-UQILNWLDSA-N |
| XLogP | 5.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|