About 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide
2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide (PubChem CID 44584936) has the molecular formula C17H16FN3OS
and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide.
Molecular Properties
| Compound Name | 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide |
| PubChem CID | 44584936 |
| Molecular Formula | C17H16FN3OS |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide |
| SMILES | N#C[C@@]1(NC(=O)C(N)Cc2sccc2F)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H16FN3OS/c18-13-6-7-23-15(13)8-14(20)16(22)21-17(10-19)9-12(17)11-4-2-1-3-5-11/h1-7,12,14H,8-9,20H2,(H,21,22)/t12-,14?,17+/m1/s1 |
| InChIKey | UUKJIEBFYVGYRF-YTQWVHSASA-N |
| XLogP | 2.32 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide?
The IUPAC name of 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide (CID 44584936) is 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide.
What is the SMILES notation for 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide?
The canonical SMILES for 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide is N#C[C@@]1(NC(=O)C(N)Cc2sccc2F)C[C@@H]1c1ccccc1.
What is the InChIKey of 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide?
The InChIKey is UUKJIEBFYVGYRF-YTQWVHSASA-N. The full InChI is InChI=1S/C17H16FN3OS/c18-13-6-7-23-15(13)8-14(20)16(22)21-17(10-19)9-12(17)11-4-2-1-3-5-11/h1-7,12,14H,8-9,20H2,(H,21,22)/t12-,14?,17+/m1/s1.
What are the key properties of 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide?
2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide has a molecular weight of 329.40 g/mol, XLogP of 2.32, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(1R,2R)-1-cyano-2-phenylcyclopropyl]-3-(3-fluorothiophen-2-yl)propanamide is sourced from PubChem (CID 44584936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).