C34H44O8Si — CID 44585215
[(4R,5R,5aS,6S,8S,9aR)-5,6-diacetyloxy-3,5a-dimethyl-9-methylidene-2-oxo-8-triethylsilyloxy-4,5,6,7,8,9a-hexahydro-1H-benzo[g]azulen-4-yl] benzoate (PubChem CID 44585215) has the molecular formula C34H44O8Si and a molecular weight of 608.80 g/mol. Its IUPAC name is [(4R,5R,5aS,6S,8S,9aR)-5,6-diacetyloxy-3,5a-dimethyl-9-methylidene-2-oxo-8-triethylsilyloxy-4,5,6,7,8,9a-hexahydro-1H-benzo[g]azulen-4-yl] benzoate.
| Compound Name | [(4R,5R,5aS,6S,8S,9aR)-5,6-diacetyloxy-3,5a-dimethyl-9-methylidene-2-oxo-8-triethylsilyloxy-4,5,6,7,8,9a-hexahydro-1H-benzo[g]azulen-4-yl] benzoate |
|---|---|
| PubChem CID | 44585215 |
| Molecular Formula | C34H44O8Si |
| Molecular Weight | 608.80 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | [(4R,5R,5aS,6S,8S,9aR)-5,6-diacetyloxy-3,5a-dimethyl-9-methylidene-2-oxo-8-triethylsilyloxy-4,5,6,7,8,9a-hexahydro-1H-benzo[g]azulen-4-yl] benzoate |
| SMILES | C=C1[C@@H](O[Si](CC)(CC)CC)C[C@H](OC(C)=O)[C@]2(C)[C@@H]1C=C1CC(=O)C(C)=C1[C@@H](OC(=O)c1ccccc1)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C34H44O8Si/c1-9-43(10-2,11-3)42-28-19-29(39-22(6)35)34(8)26(20(28)4)17-25-18-27(37)21(5)30(25)31(32(34)40-23(7)36)41-33(38)24-15-13-12-14-16-24/h12-17,26,28-29,31-32H,4,9-11,18-19H2,1-3,5-8H3/t26-,28+,29+,31-,32+,34+/m1/s1 |
| InChIKey | CINDNJJUDJVRPD-IVDDQONWSA-N |
| XLogP | 6.28 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.80 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|