C16H23NO4 — CID 44585219
(2R,3S,4S,5R)-2-(hydroxymethyl)-5-[(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]oxolane-3,4-diol (PubChem CID 44585219) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(hydroxymethyl)-5-[(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-5-[(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 44585219 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-5-[(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@H](CNC2CCCc3ccccc32)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H23NO4/c18-9-14-16(20)15(19)13(21-14)8-17-12-7-3-5-10-4-1-2-6-11(10)12/h1-2,4,6,12-20H,3,5,7-9H2/t12?,13-,14-,15-,16-/m1/s1 |
| InChIKey | ZGZAQSBHJCLPPG-PBKGSFDCSA-N |
| XLogP | 0.14 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |