About 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide
6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide (PubChem CID 44585259) has the molecular formula C16H22N4O4
and a molecular weight of 334.38 g/mol. Its IUPAC name is 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide.
Molecular Properties
| Compound Name | 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide |
| PubChem CID | 44585259 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide |
| SMILES | COc1cccc(OC)c1-c1cn(CCCCCC(=O)NO)nn1 |
| InChI | InChI=1S/C16H22N4O4/c1-23-13-7-6-8-14(24-2)16(13)12-11-20(19-17-12)10-5-3-4-9-15(21)18-22/h6-8,11,22H,3-5,9-10H2,1-2H3,(H,18,21) |
| InChIKey | SOWMPEPQTOSDTL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide?
The IUPAC name of 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide (CID 44585259) is 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide.
What is the SMILES notation for 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide?
The canonical SMILES for 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide is COc1cccc(OC)c1-c1cn(CCCCCC(=O)NO)nn1.
What is the InChIKey of 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide?
The InChIKey is SOWMPEPQTOSDTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O4/c1-23-13-7-6-8-14(24-2)16(13)12-11-20(19-17-12)10-5-3-4-9-15(21)18-22/h6-8,11,22H,3-5,9-10H2,1-2H3,(H,18,21).
What are the key properties of 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide?
6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide has a molecular weight of 334.38 g/mol, XLogP of 2.03, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(2,6-dimethoxyphenyl)triazol-1-yl]-N-hydroxyhexanamide is sourced from PubChem (CID 44585259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).