C33H38O10 — CID 44585421
[(1S,2S,3S,7S,8S,9R,10R,13R)-2,7,9-triacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-oxo-14-oxatetracyclo[11.2.1.01,11.03,8]hexadec-11-en-10-yl] benzoate (PubChem CID 44585421) has the molecular formula C33H38O10 and a molecular weight of 594.66 g/mol. Its IUPAC name is [(1S,2S,3S,7S,8S,9R,10R,13R)-2,7,9-triacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-oxo-14-oxatetracyclo[11.2.1.01,11.03,8]hexadec-11-en-10-yl] benzoate.
| Compound Name | [(1S,2S,3S,7S,8S,9R,10R,13R)-2,7,9-triacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-oxo-14-oxatetracyclo[11.2.1.01,11.03,8]hexadec-11-en-10-yl] benzoate |
|---|---|
| PubChem CID | 44585421 |
| Molecular Formula | C33H38O10 |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | [(1S,2S,3S,7S,8S,9R,10R,13R)-2,7,9-triacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-oxo-14-oxatetracyclo[11.2.1.01,11.03,8]hexadec-11-en-10-yl] benzoate |
| SMILES | C=C1C(=O)C[C@H](OC(C)=O)[C@@]2(C)[C@@H](OC(C)=O)[C@H](OC(=O)c3ccccc3)C3=C(C)[C@H]4C[C@]3([C@@H](OC(C)=O)[C@H]12)C(C)(C)O4 |
| InChI | InChI=1S/C33H38O10/c1-16-22(37)14-24(39-18(3)34)32(8)26(16)28(40-19(4)35)33-15-23(43-31(33,6)7)17(2)25(33)27(29(32)41-20(5)36)42-30(38)21-12-10-9-11-13-21/h9-13,23-24,26-29H,1,14-15H2,2-8H3/t23-,24+,26+,27-,28+,29+,32-,33+/m1/s1 |
| InChIKey | HSLXCYQESDPLCU-IBLIIHSQSA-N |
| XLogP | 4.06 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|