C25H44O5 — CID 44585437
(2S)-2-[(3S,6S)-6-[2-[(1R,2R,4aS,8aS)-1-hydroxy-2,4a,5,5,8a-pentamethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid (PubChem CID 44585437) has the molecular formula C25H44O5 and a molecular weight of 424.62 g/mol. Its IUPAC name is (2S)-2-[(3S,6S)-6-[2-[(1R,2R,4aS,8aS)-1-hydroxy-2,4a,5,5,8a-pentamethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid.
| Compound Name | (2S)-2-[(3S,6S)-6-[2-[(1R,2R,4aS,8aS)-1-hydroxy-2,4a,5,5,8a-pentamethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 44585437 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | (2S)-2-[(3S,6S)-6-[2-[(1R,2R,4aS,8aS)-1-hydroxy-2,4a,5,5,8a-pentamethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid |
| SMILES | C[C@H](C(=O)O)[C@@H]1CC[C@@](C)(CC[C@@]2(O)[C@H](C)CC[C@@]3(C)C(C)(C)CCC[C@]23C)OO1 |
| InChI | InChI=1S/C25H44O5/c1-17-9-14-23(6)21(3,4)11-8-12-24(23,7)25(17,28)16-15-22(5)13-10-19(29-30-22)18(2)20(26)27/h17-19,28H,8-16H2,1-7H3,(H,26,27)/t17-,18+,19+,22+,23+,24+,25-/m1/s1 |
| InChIKey | XDZGQQRZJDKPTG-HBNQUELISA-N |
| XLogP | 5.74 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|