C27H40O4 — CID 44585482
methyl 2-[(3R,5R)-3,5-dimethyl-5-[(7E,11Z)-2-methyl-12-phenyldodeca-7,11-dienyl]dioxolan-3-yl]acetate (PubChem CID 44585482) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is methyl 2-[(3R,5R)-3,5-dimethyl-5-[(7E,11Z)-2-methyl-12-phenyldodeca-7,11-dienyl]dioxolan-3-yl]acetate.
| Compound Name | methyl 2-[(3R,5R)-3,5-dimethyl-5-[(7E,11Z)-2-methyl-12-phenyldodeca-7,11-dienyl]dioxolan-3-yl]acetate |
|---|---|
| PubChem CID | 44585482 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | methyl 2-[(3R,5R)-3,5-dimethyl-5-[(7E,11Z)-2-methyl-12-phenyldodeca-7,11-dienyl]dioxolan-3-yl]acetate |
| SMILES | COC(=O)C[C@@]1(C)C[C@@](C)(CC(C)CCCC/C=C/CC/C=C\c2ccccc2)OO1 |
| InChI | InChI=1S/C27H40O4/c1-23(20-26(2)22-27(3,31-30-26)21-25(28)29-4)16-12-9-7-5-6-8-10-13-17-24-18-14-11-15-19-24/h5-6,11,13-15,17-19,23H,7-10,12,16,20-22H2,1-4H3/b6-5+,17-13-/t23?,26-,27+/m1/s1 |
| InChIKey | WRRKXRPXPWHLPK-JMECKBNFSA-N |
| XLogP | 7.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|