C25H40O4 — CID 44585483
methyl 2-[(3R,5S)-3,5-dimethyl-5-(2-methyl-10-phenyldecyl)dioxolan-3-yl]acetate (PubChem CID 44585483) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is methyl 2-[(3R,5S)-3,5-dimethyl-5-(2-methyl-10-phenyldecyl)dioxolan-3-yl]acetate.
| Compound Name | methyl 2-[(3R,5S)-3,5-dimethyl-5-(2-methyl-10-phenyldecyl)dioxolan-3-yl]acetate |
|---|---|
| PubChem CID | 44585483 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | methyl 2-[(3R,5S)-3,5-dimethyl-5-(2-methyl-10-phenyldecyl)dioxolan-3-yl]acetate |
| SMILES | COC(=O)C[C@@]1(C)C[C@](C)(CC(C)CCCCCCCCc2ccccc2)OO1 |
| InChI | InChI=1S/C25H40O4/c1-21(18-24(2)20-25(3,29-28-24)19-23(26)27-4)14-10-7-5-6-8-11-15-22-16-12-9-13-17-22/h9,12-13,16-17,21H,5-8,10-11,14-15,18-20H2,1-4H3/t21?,24-,25-/m0/s1 |
| InChIKey | TWGPUNAPRZRUAG-MHKYCTGGSA-N |
| XLogP | 6.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|