C19H32O5 — CID 44585485
methyl 2-[(3S,4S,6R)-4,6-diethyl-6-[(E)-2-[(2R,3S)-3-ethyloxiran-2-yl]but-1-enyl]dioxan-3-yl]acetate (PubChem CID 44585485) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is methyl 2-[(3S,4S,6R)-4,6-diethyl-6-[(E)-2-[(2R,3S)-3-ethyloxiran-2-yl]but-1-enyl]dioxan-3-yl]acetate.
| Compound Name | methyl 2-[(3S,4S,6R)-4,6-diethyl-6-[(E)-2-[(2R,3S)-3-ethyloxiran-2-yl]but-1-enyl]dioxan-3-yl]acetate |
|---|---|
| PubChem CID | 44585485 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | methyl 2-[(3S,4S,6R)-4,6-diethyl-6-[(E)-2-[(2R,3S)-3-ethyloxiran-2-yl]but-1-enyl]dioxan-3-yl]acetate |
| SMILES | CC/C(=C\[C@@]1(CC)C[C@H](CC)[C@H](CC(=O)OC)OO1)[C@H]1O[C@H]1CC |
| InChI | InChI=1S/C19H32O5/c1-6-13-11-19(9-4,24-23-16(13)10-17(20)21-5)12-14(7-2)18-15(8-3)22-18/h12-13,15-16,18H,6-11H2,1-5H3/b14-12+/t13-,15-,16-,18+,19+/m0/s1 |
| InChIKey | CFXNHQNIKKFEDQ-LSWVZCMGSA-N |
| XLogP | 3.96 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|