C20H32O5 — CID 44585492
methyl 2-[(3S,6R)-6-[(8E,10E)-dodeca-8,10-dienyl]-6-methoxy-3H-1,2-dioxin-3-yl]acetate (PubChem CID 44585492) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is methyl 2-[(3S,6R)-6-[(8E,10E)-dodeca-8,10-dienyl]-6-methoxy-3H-1,2-dioxin-3-yl]acetate.
| Compound Name | methyl 2-[(3S,6R)-6-[(8E,10E)-dodeca-8,10-dienyl]-6-methoxy-3H-1,2-dioxin-3-yl]acetate |
|---|---|
| PubChem CID | 44585492 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | methyl 2-[(3S,6R)-6-[(8E,10E)-dodeca-8,10-dienyl]-6-methoxy-3H-1,2-dioxin-3-yl]acetate |
| SMILES | C/C=C/C=C/CCCCCCC[C@]1(OC)C=C[C@H](CC(=O)OC)OO1 |
| InChI | InChI=1S/C20H32O5/c1-4-5-6-7-8-9-10-11-12-13-15-20(23-3)16-14-18(24-25-20)17-19(21)22-2/h4-7,14,16,18H,8-13,15,17H2,1-3H3/b5-4+,7-6+/t18-,20-/m1/s1 |
| InChIKey | UGLSVZMADGXVFK-BQNQRPFHSA-N |
| XLogP | 4.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|