C8H10FN3O4S — CID 44585531
5-fluoro-4-(hydroxyamino)-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one (PubChem CID 44585531) has the molecular formula C8H10FN3O4S and a molecular weight of 263.25 g/mol. Its IUPAC name is 5-fluoro-4-(hydroxyamino)-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one.
| Compound Name | 5-fluoro-4-(hydroxyamino)-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 44585531 |
| Molecular Formula | C8H10FN3O4S |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 5-fluoro-4-(hydroxyamino)-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| SMILES | O=c1nc(NO)c(F)cn1[C@@H]1CS[C@H](CO)O1 |
| InChI | InChI=1S/C8H10FN3O4S/c9-4-1-12(8(14)10-7(4)11-15)5-3-17-6(2-13)16-5/h1,5-6,13,15H,2-3H2,(H,10,11,14)/t5-,6+/m0/s1 |
| InChIKey | DARJJZWNGZHUAQ-NTSWFWBYSA-N |
| XLogP | -0.24 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|