About 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine
2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine (PubChem CID 44585620) has the molecular formula C24H31Cl2N3
and a molecular weight of 432.44 g/mol. Its IUPAC name is 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine |
| PubChem CID | 44585620 |
| Molecular Formula | C24H31Cl2N3 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine |
| SMILES | CN(C)C12CCN(CCN)C(C(c3ccc(Cl)cc3)C1)C(c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C24H31Cl2N3/c1-28(2)24-11-13-29(14-12-27)23(21(15-24)17-3-7-19(25)8-4-17)22(16-24)18-5-9-20(26)10-6-18/h3-10,21-23H,11-16,27H2,1-2H3 |
| InChIKey | SFTYSIKUZZQXOM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine?
The IUPAC name of 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine (CID 44585620) is 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine.
What is the SMILES notation for 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine?
The canonical SMILES for 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine is CN(C)C12CCN(CCN)C(C(c3ccc(Cl)cc3)C1)C(c1ccc(Cl)cc1)C2.
What is the InChIKey of 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine?
The InChIKey is SFTYSIKUZZQXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31Cl2N3/c1-28(2)24-11-13-29(14-12-27)23(21(15-24)17-3-7-19(25)8-4-17)22(16-24)18-5-9-20(26)10-6-18/h3-10,21-23H,11-16,27H2,1-2H3.
What are the key properties of 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine?
2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine has a molecular weight of 432.44 g/mol, XLogP of 4.99, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)-7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine is sourced from PubChem (CID 44585620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).