About 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride
5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride (PubChem CID 44585629) has the molecular formula C16H16ClNO
and a molecular weight of 273.76 g/mol. Its IUPAC name is 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride |
| PubChem CID | 44585629 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride |
| SMILES | Cl.c1ccc(CC2CC(c3ccccc3)=NO2)cc1 |
| InChI | InChI=1S/C16H15NO.ClH/c1-3-7-13(8-4-1)11-15-12-16(17-18-15)14-9-5-2-6-10-14;/h1-10,15H,11-12H2;1H |
| InChIKey | GLUBZQZBECWVRC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride?
The IUPAC name of 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride (CID 44585629) is 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride.
What is the SMILES notation for 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride?
The canonical SMILES for 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride is Cl.c1ccc(CC2CC(c3ccccc3)=NO2)cc1.
What is the InChIKey of 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride?
The InChIKey is GLUBZQZBECWVRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO.ClH/c1-3-7-13(8-4-1)11-15-12-16(17-18-15)14-9-5-2-6-10-14;/h1-10,15H,11-12H2;1H.
What are the key properties of 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride?
5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride has a molecular weight of 273.76 g/mol, XLogP of 3.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole;hydrochloride is sourced from PubChem (CID 44585629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).